C18H29ClN2O3 — CID 120789949
2-amino-N-[[3-(2-methylpropoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120789949) has the molecular formula C18H29ClN2O3 and a molecular weight of 356.89 g/mol. Its IUPAC name is 2-amino-N-[[3-(2-methylpropoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[[3-(2-methylpropoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120789949 |
| Molecular Formula | C18H29ClN2O3 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 2-amino-N-[[3-(2-methylpropoxy)phenyl]methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | CC(C)COc1cccc(CNC(=O)C(N)C2CCOCC2)c1.Cl |
| InChI | InChI=1S/C18H28N2O3.ClH/c1-13(2)12-23-16-5-3-4-14(10-16)11-20-18(21)17(19)15-6-8-22-9-7-15;/h3-5,10,13,15,17H,6-9,11-12,19H2,1-2H3,(H,20,21);1H |
| InChIKey | ORGXKSQWURGTNP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |