C17H26N2O4 — CID 120792906
2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide (PubChem CID 120792906) has the molecular formula C17H26N2O4 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide.
| Compound Name | 2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 120792906 |
| Molecular Formula | C17H26N2O4 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.19 |
| IUPAC Name | 2-amino-N-[(3-ethoxy-4-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide |
| SMILES | CCOc1cc(CNC(=O)C(N)C2CCOCC2)ccc1OC |
| InChI | InChI=1S/C17H26N2O4/c1-3-23-15-10-12(4-5-14(15)21-2)11-19-17(20)16(18)13-6-8-22-9-7-13/h4-5,10,13,16H,3,6-9,11,18H2,1-2H3,(H,19,20) |
| InChIKey | KQHVLEIYXQIACH-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |