C15H22BrClN2O3 — CID 120788733
2-amino-N-[(2-bromo-5-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide;hydrochloride (PubChem CID 120788733) has the molecular formula C15H22BrClN2O3 and a molecular weight of 393.71 g/mol. Its IUPAC name is 2-amino-N-[(2-bromo-5-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[(2-bromo-5-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120788733 |
| Molecular Formula | C15H22BrClN2O3 |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 2-amino-N-[(2-bromo-5-methoxyphenyl)methyl]-2-(oxan-4-yl)acetamide;hydrochloride |
| SMILES | COc1ccc(Br)c(CNC(=O)C(N)C2CCOCC2)c1.Cl |
| InChI | InChI=1S/C15H21BrN2O3.ClH/c1-20-12-2-3-13(16)11(8-12)9-18-15(19)14(17)10-4-6-21-7-5-10;/h2-3,8,10,14H,4-7,9,17H2,1H3,(H,18,19);1H |
| InChIKey | QFAIFHPLMGTFJG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |