C29H28N4O3 — CID 57406405
4-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(3-phenylmethoxyphenyl)oxane-4-carboxamide (PubChem CID 57406405) has the molecular formula C29H28N4O3 and a molecular weight of 480.57 g/mol. Its IUPAC name is 4-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(3-phenylmethoxyphenyl)oxane-4-carboxamide.
| Compound Name | 4-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(3-phenylmethoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 57406405 |
| Molecular Formula | C29H28N4O3 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | 4-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(3-phenylmethoxyphenyl)oxane-4-carboxamide |
| SMILES | Nc1ncc(-c2ccc(C3(C(=O)Nc4cccc(OCc5ccccc5)c4)CCOCC3)cc2)cn1 |
| InChI | InChI=1S/C29H28N4O3/c30-28-31-18-23(19-32-28)22-9-11-24(12-10-22)29(13-15-35-16-14-29)27(34)33-25-7-4-8-26(17-25)36-20-21-5-2-1-3-6-21/h1-12,17-19H,13-16,20H2,(H,33,34)(H2,30,31,32) |
| InChIKey | IFGQXFRNLMIVCJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |