C25H27N5O2 — CID 67987762
1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(4-morpholin-4-ylphenyl)cyclobutane-1-carboxamide (PubChem CID 67987762) has the molecular formula C25H27N5O2 and a molecular weight of 429.52 g/mol. Its IUPAC name is 1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(4-morpholin-4-ylphenyl)cyclobutane-1-carboxamide.
| Compound Name | 1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(4-morpholin-4-ylphenyl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 67987762 |
| Molecular Formula | C25H27N5O2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.22 |
| IUPAC Name | 1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(4-morpholin-4-ylphenyl)cyclobutane-1-carboxamide |
| SMILES | Nc1ncc(-c2ccc(C3(C(=O)Nc4ccc(N5CCOCC5)cc4)CCC3)cc2)cn1 |
| InChI | InChI=1S/C25H27N5O2/c26-24-27-16-19(17-28-24)18-2-4-20(5-3-18)25(10-1-11-25)23(31)29-21-6-8-22(9-7-21)30-12-14-32-15-13-30/h2-9,16-17H,1,10-15H2,(H,29,31)(H2,26,27,28) |
| InChIKey | PLFSCADJGYUWAK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|