C20H19N5O2 — CID 57406950
1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(6-oxo-1H-pyridin-3-yl)cyclobutane-1-carboxamide (PubChem CID 57406950) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(6-oxo-1H-pyridin-3-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(6-oxo-1H-pyridin-3-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 57406950 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 1-[4-(2-aminopyrimidin-5-yl)phenyl]-N-(6-oxo-1H-pyridin-3-yl)cyclobutane-1-carboxamide |
| SMILES | Nc1ncc(-c2ccc(C3(C(=O)Nc4ccc(=O)[nH]c4)CCC3)cc2)cn1 |
| InChI | InChI=1S/C20H19N5O2/c21-19-23-10-14(11-24-19)13-2-4-15(5-3-13)20(8-1-9-20)18(27)25-16-6-7-17(26)22-12-16/h2-7,10-12H,1,8-9H2,(H,22,26)(H,25,27)(H2,21,23,24) |
| InChIKey | FLPHYEVLTZPTNS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |