C25H28N4O3S — CID 112819680
1-ethylsulfonyl-N-[3-(2-methylpyrimidin-4-yl)phenyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 112819680) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 1-ethylsulfonyl-N-[3-(2-methylpyrimidin-4-yl)phenyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | 1-ethylsulfonyl-N-[3-(2-methylpyrimidin-4-yl)phenyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 112819680 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 1-ethylsulfonyl-N-[3-(2-methylpyrimidin-4-yl)phenyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | CCS(=O)(=O)N1CCC(C(=O)Nc2cccc(-c3ccnc(C)n3)c2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H28N4O3S/c1-3-33(31,32)29-16-13-25(14-17-29,21-9-5-4-6-10-21)24(30)28-22-11-7-8-20(18-22)23-12-15-26-19(2)27-23/h4-12,15,18H,3,13-14,16-17H2,1-2H3,(H,28,30) |
| InChIKey | AFBBFYBTYYZYQP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |