C22H18N4O4S — CID 26164901
N-[[3-[(3-methylphenyl)carbamoyl]phenyl]carbamothioyl]-2-nitrobenzamide (PubChem CID 26164901) has the molecular formula C22H18N4O4S and a molecular weight of 434.48 g/mol. Its IUPAC name is N-[[3-[(3-methylphenyl)carbamoyl]phenyl]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[3-[(3-methylphenyl)carbamoyl]phenyl]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 26164901 |
| Molecular Formula | C22H18N4O4S |
| Molecular Weight | 434.48 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | N-[[3-[(3-methylphenyl)carbamoyl]phenyl]carbamothioyl]-2-nitrobenzamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(NC(=S)NC(=O)c3ccccc3[N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C22H18N4O4S/c1-14-6-4-8-16(12-14)23-20(27)15-7-5-9-17(13-15)24-22(31)25-21(28)18-10-2-3-11-19(18)26(29)30/h2-13H,1H3,(H,23,27)(H2,24,25,28,31) |
| InChIKey | BSTXJMMNHSEYJQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|