C21H16N6O3S — CID 1339443
N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-2-nitrobenzamide (PubChem CID 1339443) has the molecular formula C21H16N6O3S and a molecular weight of 432.47 g/mol. Its IUPAC name is N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-2-nitrobenzamide.
| Compound Name | N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-2-nitrobenzamide |
|---|---|
| PubChem CID | 1339443 |
| Molecular Formula | C21H16N6O3S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-[[2-(4-methylphenyl)benzotriazol-5-yl]carbamothioyl]-2-nitrobenzamide |
| SMILES | Cc1ccc(-n2nc3ccc(NC(=S)NC(=O)c4ccccc4[N+](=O)[O-])cc3n2)cc1 |
| InChI | InChI=1S/C21H16N6O3S/c1-13-6-9-15(10-7-13)26-24-17-11-8-14(12-18(17)25-26)22-21(31)23-20(28)16-4-2-3-5-19(16)27(29)30/h2-12H,1H3,(H2,22,23,28,31) |
| InChIKey | GTZYLFSGHDGXFM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 114.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|