C22H19N5OS — CID 3470943
2,4-dimethyl-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]benzamide (PubChem CID 3470943) has the molecular formula C22H19N5OS and a molecular weight of 401.50 g/mol. Its IUPAC name is 2,4-dimethyl-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 2,4-dimethyl-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3470943 |
| Molecular Formula | C22H19N5OS |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2,4-dimethyl-N-[(2-phenylbenzotriazol-5-yl)carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc3nn(-c4ccccc4)nc3c2)c(C)c1 |
| InChI | InChI=1S/C22H19N5OS/c1-14-8-10-18(15(2)12-14)21(28)24-22(29)23-16-9-11-19-20(13-16)26-27(25-19)17-6-4-3-5-7-17/h3-13H,1-2H3,(H2,23,24,28,29) |
| InChIKey | XHVCFSHVXZHPPU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|