C22H25N3O2S — CID 54786576
N-benzyl-3-[(2-cyclopentylacetyl)carbamothioylamino]benzamide (PubChem CID 54786576) has the molecular formula C22H25N3O2S and a molecular weight of 395.53 g/mol. Its IUPAC name is N-benzyl-3-[(2-cyclopentylacetyl)carbamothioylamino]benzamide.
| Compound Name | N-benzyl-3-[(2-cyclopentylacetyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 54786576 |
| Molecular Formula | C22H25N3O2S |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | N-benzyl-3-[(2-cyclopentylacetyl)carbamothioylamino]benzamide |
| SMILES | O=C(CC1CCCC1)NC(=S)Nc1cccc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H25N3O2S/c26-20(13-16-7-4-5-8-16)25-22(28)24-19-12-6-11-18(14-19)21(27)23-15-17-9-2-1-3-10-17/h1-3,6,9-12,14,16H,4-5,7-8,13,15H2,(H,23,27)(H2,24,25,26,28) |
| InChIKey | VAAGUDYMVMNJTM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|