C24H32N6O7 — CID 131716500
N-[2-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]ethyl]furan-3-carboxamide;oxalic acid (PubChem CID 131716500) has the molecular formula C24H32N6O7 and a molecular weight of 516.56 g/mol. Its IUPAC name is N-[2-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]ethyl]furan-3-carboxamide;oxalic acid.
| Compound Name | N-[2-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]ethyl]furan-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 131716500 |
| Molecular Formula | C24H32N6O7 |
| Molecular Weight | 516.56 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | N-[2-[4-[[3-(2-ethoxyethyl)imidazo[4,5-b]pyridin-2-yl]methyl]piperazin-1-yl]ethyl]furan-3-carboxamide;oxalic acid |
| SMILES | CCOCCn1c(CN2CCN(CCNC(=O)c3ccoc3)CC2)nc2cccnc21.O=C(O)C(=O)O |
| InChI | InChI=1S/C22H30N6O3.C2H2O4/c1-2-30-15-13-28-20(25-19-4-3-6-23-21(19)28)16-27-11-9-26(10-12-27)8-7-24-22(29)18-5-14-31-17-18;3-1(4)2(5)6/h3-6,14,17H,2,7-13,15-16H2,1H3,(H,24,29);(H,3,4)(H,5,6) |
| InChIKey | JSBOQYOYASGLAL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 163.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.56 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|