C21H33BrN4O — CID 10836708
8-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]-8-aza-5-azoniaspiro[4.6]undecane bromide (PubChem CID 10836708) has the molecular formula C21H33BrN4O and a molecular weight of 437.43 g/mol. Its IUPAC name is 8-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]-8-aza-5-azoniaspiro[4.6]undecane bromide.
| Compound Name | 8-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]-8-aza-5-azoniaspiro[4.6]undecane bromide |
|---|---|
| PubChem CID | 10836708 |
| Molecular Formula | C21H33BrN4O |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 8-[[1-(2-ethoxyethyl)benzimidazol-2-yl]methyl]-8-aza-5-azoniaspiro[4.6]undecane bromide |
| SMILES | CCOCCn1c(CN2CCC[N+]3(CCCC3)CC2)nc2ccccc21.[Br-] |
| InChI | InChI=1S/C21H33N4O.BrH/c1-2-26-17-12-24-20-9-4-3-8-19(20)22-21(24)18-23-10-7-15-25(16-11-23)13-5-6-14-25;/h3-4,8-9H,2,5-7,10-18H2,1H3;1H/q+1;/p-1 |
| InChIKey | GQNVBUDKWNFBFT-UHFFFAOYSA-M |
| XLogP | -0.11 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|