C20H31N4O+ — CID 10812202
8-[1-(2-ethoxyethyl)benzimidazol-2-yl]-8-aza-5-azoniaspiro[4.6]undecane (PubChem CID 10812202) has the molecular formula C20H31N4O+ and a molecular weight of 343.50 g/mol. Its IUPAC name is 8-[1-(2-ethoxyethyl)benzimidazol-2-yl]-8-aza-5-azoniaspiro[4.6]undecane.
| Compound Name | 8-[1-(2-ethoxyethyl)benzimidazol-2-yl]-8-aza-5-azoniaspiro[4.6]undecane |
|---|---|
| PubChem CID | 10812202 |
| Molecular Formula | C20H31N4O+ |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 8-[1-(2-ethoxyethyl)benzimidazol-2-yl]-8-aza-5-azoniaspiro[4.6]undecane |
| SMILES | CCOCCn1c(N2CCC[N+]3(CCCC3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C20H31N4O/c1-2-25-17-12-23-19-9-4-3-8-18(19)21-20(23)22-10-7-15-24(16-11-22)13-5-6-14-24/h3-4,8-9H,2,5-7,10-17H2,1H3/q+1 |
| InChIKey | QQWSYJBEXSSTAO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|