C17H26N4O — CID 46889258
(3S)-1-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N,N-dimethylpyrrolidin-3-amine (PubChem CID 46889258) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is (3S)-1-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N,N-dimethylpyrrolidin-3-amine.
| Compound Name | (3S)-1-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N,N-dimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 46889258 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (3S)-1-[1-(2-ethoxyethyl)benzimidazol-2-yl]-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CCOCCn1c(N2CC[C@H](N(C)C)C2)nc2ccccc21 |
| InChI | InChI=1S/C17H26N4O/c1-4-22-12-11-21-16-8-6-5-7-15(16)18-17(21)20-10-9-14(13-20)19(2)3/h5-8,14H,4,9-13H2,1-3H3/t14-/m0/s1 |
| InChIKey | VILNAIPEYFWQQH-AWEZNQCLSA-N |
| XLogP | 2.21 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|