C19H29N3O2 — CID 121452091
3-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]propan-1-ol (PubChem CID 121452091) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 3-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 121452091 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 3-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]propan-1-ol |
| SMILES | CCOCCn1c(C2CCN(CCCO)CC2)nc2ccccc21 |
| InChI | InChI=1S/C19H29N3O2/c1-2-24-15-13-22-18-7-4-3-6-17(18)20-19(22)16-8-11-21(12-9-16)10-5-14-23/h3-4,6-7,16,23H,2,5,8-15H2,1H3 |
| InChIKey | FMMNCTACWXAKOI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|