C28H37N3O3 — CID 141410027
methyl 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]ethyl]phenyl]propanoate (PubChem CID 141410027) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is methyl 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]ethyl]phenyl]propanoate.
| Compound Name | methyl 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 141410027 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | methyl 2-[4-[2-[4-[1-(2-ethoxyethyl)benzimidazol-2-yl]piperidin-1-yl]ethyl]phenyl]propanoate |
| SMILES | CCOCCn1c(C2CCN(CCc3ccc(C(C)C(=O)OC)cc3)CC2)nc2ccccc21 |
| InChI | InChI=1S/C28H37N3O3/c1-4-34-20-19-31-26-8-6-5-7-25(26)29-27(31)24-14-17-30(18-15-24)16-13-22-9-11-23(12-10-22)21(2)28(32)33-3/h5-12,21,24H,4,13-20H2,1-3H3 |
| InChIKey | MXQNTUYYIBBPTI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|