C19H29N5OS — CID 3733941
N-(3-ethoxypropyl)-4-(1-ethylbenzimidazol-2-yl)piperazine-1-carbothioamide (PubChem CID 3733941) has the molecular formula C19H29N5OS and a molecular weight of 375.54 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-4-(1-ethylbenzimidazol-2-yl)piperazine-1-carbothioamide.
| Compound Name | N-(3-ethoxypropyl)-4-(1-ethylbenzimidazol-2-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3733941 |
| Molecular Formula | C19H29N5OS |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | N-(3-ethoxypropyl)-4-(1-ethylbenzimidazol-2-yl)piperazine-1-carbothioamide |
| SMILES | CCOCCCNC(=S)N1CCN(c2nc3ccccc3n2CC)CC1 |
| InChI | InChI=1S/C19H29N5OS/c1-3-24-17-9-6-5-8-16(17)21-18(24)22-11-13-23(14-12-22)19(26)20-10-7-15-25-4-2/h5-6,8-9H,3-4,7,10-15H2,1-2H3,(H,20,26) |
| InChIKey | RUDQSWMTRLGPLR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 45.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|