C21H30N4O3 — CID 91951424
N-(3-ethoxypropyl)-3-(2-oxo-3-piperidin-1-ylquinoxalin-1-yl)propanamide (PubChem CID 91951424) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-(2-oxo-3-piperidin-1-ylquinoxalin-1-yl)propanamide.
| Compound Name | N-(3-ethoxypropyl)-3-(2-oxo-3-piperidin-1-ylquinoxalin-1-yl)propanamide |
|---|---|
| PubChem CID | 91951424 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-(3-ethoxypropyl)-3-(2-oxo-3-piperidin-1-ylquinoxalin-1-yl)propanamide |
| SMILES | CCOCCCNC(=O)CCn1c(=O)c(N2CCCCC2)nc2ccccc21 |
| InChI | InChI=1S/C21H30N4O3/c1-2-28-16-8-12-22-19(26)11-15-25-18-10-5-4-9-17(18)23-20(21(25)27)24-13-6-3-7-14-24/h4-5,9-10H,2-3,6-8,11-16H2,1H3,(H,22,26) |
| InChIKey | FDMFEPJKYDLJIH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|