C15H21N5S — CID 1462205
4-(1-ethylbenzimidazol-2-yl)-N-methylpiperazine-1-carbothioamide (PubChem CID 1462205) has the molecular formula C15H21N5S and a molecular weight of 303.44 g/mol. Its IUPAC name is 4-(1-ethylbenzimidazol-2-yl)-N-methylpiperazine-1-carbothioamide.
| Compound Name | 4-(1-ethylbenzimidazol-2-yl)-N-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1462205 |
| Molecular Formula | C15H21N5S |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 4-(1-ethylbenzimidazol-2-yl)-N-methylpiperazine-1-carbothioamide |
| SMILES | CCn1c(N2CCN(C(=S)NC)CC2)nc2ccccc21 |
| InChI | InChI=1S/C15H21N5S/c1-3-20-13-7-5-4-6-12(13)17-14(20)18-8-10-19(11-9-18)15(21)16-2/h4-7H,3,8-11H2,1-2H3,(H,16,21) |
| InChIKey | BAZKWMOLZNROLR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 36.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|