C21H26N2O4S — CID 8617605
N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(3-methylbutoxy)benzohydrazide (PubChem CID 8617605) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(3-methylbutoxy)benzohydrazide.
| Compound Name | N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(3-methylbutoxy)benzohydrazide |
|---|---|
| PubChem CID | 8617605 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N'-(2,3-dihydro-1H-inden-5-ylsulfonyl)-4-(3-methylbutoxy)benzohydrazide |
| SMILES | CC(C)CCOc1ccc(C(=O)NNS(=O)(=O)c2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C21H26N2O4S/c1-15(2)12-13-27-19-9-6-17(7-10-19)21(24)22-23-28(25,26)20-11-8-16-4-3-5-18(16)14-20/h6-11,14-15,23H,3-5,12-13H2,1-2H3,(H,22,24) |
| InChIKey | HCPFSEHQMBGHJK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|