C17H17BrN2O3S — CID 26951568
4-bromo-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)benzohydrazide (PubChem CID 26951568) has the molecular formula C17H17BrN2O3S and a molecular weight of 409.31 g/mol. Its IUPAC name is 4-bromo-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)benzohydrazide.
| Compound Name | 4-bromo-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)benzohydrazide |
|---|---|
| PubChem CID | 26951568 |
| Molecular Formula | C17H17BrN2O3S |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 4-bromo-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)benzohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)CCCC2)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H17BrN2O3S/c18-15-8-5-13(6-9-15)17(21)19-20-24(22,23)16-10-7-12-3-1-2-4-14(12)11-16/h5-11,20H,1-4H2,(H,19,21) |
| InChIKey | DLRIYJJHIROHLZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|