C20H20N4O3S — CID 17433853
3-phenyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)imidazole-4-carbohydrazide (PubChem CID 17433853) has the molecular formula C20H20N4O3S and a molecular weight of 396.47 g/mol. Its IUPAC name is 3-phenyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)imidazole-4-carbohydrazide.
| Compound Name | 3-phenyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)imidazole-4-carbohydrazide |
|---|---|
| PubChem CID | 17433853 |
| Molecular Formula | C20H20N4O3S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 3-phenyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)imidazole-4-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)CCCC2)c1cncn1-c1ccccc1 |
| InChI | InChI=1S/C20H20N4O3S/c25-20(19-13-21-14-24(19)17-8-2-1-3-9-17)22-23-28(26,27)18-11-10-15-6-4-5-7-16(15)12-18/h1-3,8-14,23H,4-7H2,(H,22,25) |
| InChIKey | KDRDTLCBQHCBBP-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|