C16H19N3O3S — CID 18092883
1-methyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)pyrrole-2-carbohydrazide (PubChem CID 18092883) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-methyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)pyrrole-2-carbohydrazide.
| Compound Name | 1-methyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 18092883 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-methyl-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)pyrrole-2-carbohydrazide |
| SMILES | Cn1cccc1C(=O)NNS(=O)(=O)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C16H19N3O3S/c1-19-10-4-7-15(19)16(20)17-18-23(21,22)14-9-8-12-5-2-3-6-13(12)11-14/h4,7-11,18H,2-3,5-6H2,1H3,(H,17,20) |
| InChIKey | SDHGKYWFMCWGPS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|