C17H13BrN4O5S — CID 25324997
2-bromo-5-[[(3-phenylimidazole-4-carbonyl)amino]sulfamoyl]benzoic acid (PubChem CID 25324997) has the molecular formula C17H13BrN4O5S and a molecular weight of 465.29 g/mol. Its IUPAC name is 2-bromo-5-[[(3-phenylimidazole-4-carbonyl)amino]sulfamoyl]benzoic acid.
| Compound Name | 2-bromo-5-[[(3-phenylimidazole-4-carbonyl)amino]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 25324997 |
| Molecular Formula | C17H13BrN4O5S |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 463.98 |
| IUPAC Name | 2-bromo-5-[[(3-phenylimidazole-4-carbonyl)amino]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NNC(=O)c2cncn2-c2ccccc2)ccc1Br |
| InChI | InChI=1S/C17H13BrN4O5S/c18-14-7-6-12(8-13(14)17(24)25)28(26,27)21-20-16(23)15-9-19-10-22(15)11-4-2-1-3-5-11/h1-10,21H,(H,20,23)(H,24,25) |
| InChIKey | VBMBYULCBPNEFJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|