C19H20N2O5S — CID 7940877
(3S)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 7940877) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is (3S)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | (3S)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 7940877 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | (3S)-N'-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc2c(c1)CCCC2)[C@@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C19H20N2O5S/c22-19(18-12-25-16-7-3-4-8-17(16)26-18)20-21-27(23,24)15-10-9-13-5-1-2-6-14(13)11-15/h3-4,7-11,18,21H,1-2,5-6,12H2,(H,20,22)/t18-/m0/s1 |
| InChIKey | GQPMOAJVCOGABI-SFHVURJKSA-N |
| XLogP | 1.71 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|