C15H13BrN2O5S — CID 71903623
N'-(4-bromophenyl)sulfonyl-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide (PubChem CID 71903623) has the molecular formula C15H13BrN2O5S and a molecular weight of 413.25 g/mol. Its IUPAC name is N'-(4-bromophenyl)sulfonyl-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide.
| Compound Name | N'-(4-bromophenyl)sulfonyl-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
|---|---|
| PubChem CID | 71903623 |
| Molecular Formula | C15H13BrN2O5S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | N'-(4-bromophenyl)sulfonyl-2,3-dihydro-1,4-benzodioxine-3-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1ccc(Br)cc1)C1COc2ccccc2O1 |
| InChI | InChI=1S/C15H13BrN2O5S/c16-10-5-7-11(8-6-10)24(20,21)18-17-15(19)14-9-22-12-3-1-2-4-13(12)23-14/h1-8,14,18H,9H2,(H,17,19) |
| InChIKey | DYUDSPSZMCDDKC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|