C14H15N5O3S — CID 9055811
N'-(4,6-dimethylpyrimidin-2-yl)-2-oxo-1,3-dihydroindole-5-sulfonohydrazide (PubChem CID 9055811) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is N'-(4,6-dimethylpyrimidin-2-yl)-2-oxo-1,3-dihydroindole-5-sulfonohydrazide.
| Compound Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-oxo-1,3-dihydroindole-5-sulfonohydrazide |
|---|---|
| PubChem CID | 9055811 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N'-(4,6-dimethylpyrimidin-2-yl)-2-oxo-1,3-dihydroindole-5-sulfonohydrazide |
| SMILES | Cc1cc(C)nc(NNS(=O)(=O)c2ccc3c(c2)CC(=O)N3)n1 |
| InChI | InChI=1S/C14H15N5O3S/c1-8-5-9(2)16-14(15-8)18-19-23(21,22)11-3-4-12-10(6-11)7-13(20)17-12/h3-6,19H,7H2,1-2H3,(H,17,20)(H,15,16,18) |
| InChIKey | OBMRELNFHDLMAZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|