C15H19N3O2S — CID 106760974
ethyl 2-[2-[2-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetate (PubChem CID 106760974) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is ethyl 2-[2-[2-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[2-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 106760974 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | ethyl 2-[2-[2-(dimethylamino)anilino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(Nc2ccccc2N(C)C)n1 |
| InChI | InChI=1S/C15H19N3O2S/c1-4-20-14(19)9-11-10-21-15(16-11)17-12-7-5-6-8-13(12)18(2)3/h5-8,10H,4,9H2,1-3H3,(H,16,17) |
| InChIKey | WUPVSRAMZBFOHC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |