C21H13F3N2S — CID 10177932
4-(4-phenylphenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazol-2-amine (PubChem CID 10177932) has the molecular formula C21H13F3N2S and a molecular weight of 382.41 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(4-phenylphenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 10177932 |
| Molecular Formula | C21H13F3N2S |
| Molecular Weight | 382.41 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-(4-phenylphenyl)-N-(2,3,4-trifluorophenyl)-1,3-thiazol-2-amine |
| SMILES | Fc1ccc(Nc2nc(-c3ccc(-c4ccccc4)cc3)cs2)c(F)c1F |
| InChI | InChI=1S/C21H13F3N2S/c22-16-10-11-17(20(24)19(16)23)25-21-26-18(12-27-21)15-8-6-14(7-9-15)13-4-2-1-3-5-13/h1-12H,(H,25,26) |
| InChIKey | OHNJJZCOSUUGPR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.41 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|