C18H20N4O5S3 — CID 5190047
ethyl 2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate (PubChem CID 5190047) has the molecular formula C18H20N4O5S3 and a molecular weight of 468.58 g/mol. Its IUPAC name is ethyl 2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 5190047 |
| Molecular Formula | C18H20N4O5S3 |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.06 |
| IUPAC Name | ethyl 2-[(4-pyrrolidin-1-ylsulfonylbenzoyl)carbamothioylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(NC(=S)NC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)n1 |
| InChI | InChI=1S/C18H20N4O5S3/c1-2-27-16(24)14-11-29-18(19-14)21-17(28)20-15(23)12-5-7-13(8-6-12)30(25,26)22-9-3-4-10-22/h5-8,11H,2-4,9-10H2,1H3,(H2,19,20,21,23,28) |
| InChIKey | UETKWZANQQAUQF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|