C22H25F3N2O4S — CID 28550723
1-(2-methoxy-5-propan-2-ylphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide (PubChem CID 28550723) has the molecular formula C22H25F3N2O4S and a molecular weight of 470.51 g/mol. Its IUPAC name is 1-(2-methoxy-5-propan-2-ylphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide.
| Compound Name | 1-(2-methoxy-5-propan-2-ylphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 28550723 |
| Molecular Formula | C22H25F3N2O4S |
| Molecular Weight | 470.51 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 1-(2-methoxy-5-propan-2-ylphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-4-carboxamide |
| SMILES | COc1ccc(C(C)C)cc1S(=O)(=O)N1CCC(C(=O)Nc2ccc(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C22H25F3N2O4S/c1-13(2)15-4-7-18(31-3)19(12-15)32(29,30)27-10-8-14(9-11-27)22(28)26-17-6-5-16(23)20(24)21(17)25/h4-7,12-14H,8-11H2,1-3H3,(H,26,28) |
| InChIKey | DNGKEOIJSJPOFF-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|