C20H21F3N2O5S — CID 43872906
1-(2,5-dimethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide (PubChem CID 43872906) has the molecular formula C20H21F3N2O5S and a molecular weight of 458.46 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide.
| Compound Name | 1-(2,5-dimethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 43872906 |
| Molecular Formula | C20H21F3N2O5S |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)sulfonyl-N-(2,3,4-trifluorophenyl)piperidine-3-carboxamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N2CCCC(C(=O)Nc3ccc(F)c(F)c3F)C2)c1 |
| InChI | InChI=1S/C20H21F3N2O5S/c1-29-13-5-8-16(30-2)17(10-13)31(27,28)25-9-3-4-12(11-25)20(26)24-15-7-6-14(21)18(22)19(15)23/h5-8,10,12H,3-4,9,11H2,1-2H3,(H,24,26) |
| InChIKey | PLZDDQKGBBDOKN-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|