C18H26FN3O4S — CID 69189183
2-[1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide (PubChem CID 69189183) has the molecular formula C18H26FN3O4S and a molecular weight of 399.49 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide.
| Compound Name | 2-[1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 69189183 |
| Molecular Formula | C18H26FN3O4S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 2-[1-(5-fluoro-2-methylphenyl)sulfonylpiperidin-3-yl]-N-morpholin-4-ylacetamide |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CCCC(CC(=O)NN2CCOCC2)C1 |
| InChI | InChI=1S/C18H26FN3O4S/c1-14-4-5-16(19)12-17(14)27(24,25)22-6-2-3-15(13-22)11-18(23)20-21-7-9-26-10-8-21/h4-5,12,15H,2-3,6-11,13H2,1H3,(H,20,23) |
| InChIKey | PPTMOLATTCOYON-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |