C25H32Cl2N4O2 — CID 70267659
N-[(2,4-dichlorophenyl)methyl]-2-[[[(1R,7S)-3-tetracyclo[5.3.1.03,9.05,9]undecanyl]carbamoylamino]methyl]pyrrolidine-1-carboxamide (PubChem CID 70267659) has the molecular formula C25H32Cl2N4O2 and a molecular weight of 491.46 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]-2-[[[(1R,7S)-3-tetracyclo[5.3.1.03,9.05,9]undecanyl]carbamoylamino]methyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(2,4-dichlorophenyl)methyl]-2-[[[(1R,7S)-3-tetracyclo[5.3.1.03,9.05,9]undecanyl]carbamoylamino]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 70267659 |
| Molecular Formula | C25H32Cl2N4O2 |
| Molecular Weight | 491.46 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]-2-[[[(1R,7S)-3-tetracyclo[5.3.1.03,9.05,9]undecanyl]carbamoylamino]methyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCC1CCCN1C(=O)NCc1ccc(Cl)cc1Cl)NC12CC3C[C@@H]4C[C@@H](C1)CC32C4 |
| InChI | InChI=1S/C25H32Cl2N4O2/c26-19-4-3-17(21(27)8-19)13-29-23(33)31-5-1-2-20(31)14-28-22(32)30-25-11-16-6-15-7-18(12-25)24(25,9-15)10-16/h3-4,8,15-16,18,20H,1-2,5-7,9-14H2,(H,29,33)(H2,28,30,32)/t15-,16+,18?,20?,24?,25?/m0/s1 |
| InChIKey | BAGWQCPHLFMQMK-OBGIWLCFSA-N |
| XLogP | 4.94 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.46 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |