C23H39ClN2O3S — CID 173136746
N-[2-[1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]ethyl]cyclooctanecarboxamide;methane (PubChem CID 173136746) has the molecular formula C23H39ClN2O3S and a molecular weight of 459.10 g/mol. Its IUPAC name is N-[2-[1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]ethyl]cyclooctanecarboxamide;methane.
| Compound Name | N-[2-[1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]ethyl]cyclooctanecarboxamide;methane |
|---|---|
| PubChem CID | 173136746 |
| Molecular Formula | C23H39ClN2O3S |
| Molecular Weight | 459.10 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | N-[2-[1-(2-chlorophenyl)sulfonylpyrrolidin-3-yl]ethyl]cyclooctanecarboxamide;methane |
| SMILES | C.C.O=C(NCCC1CCN(S(=O)(=O)c2ccccc2Cl)C1)C1CCCCCCC1 |
| InChI | InChI=1S/C21H31ClN2O3S.2CH4/c22-19-10-6-7-11-20(19)28(26,27)24-15-13-17(16-24)12-14-23-21(25)18-8-4-2-1-3-5-9-18;;/h6-7,10-11,17-18H,1-5,8-9,12-16H2,(H,23,25);2*1H4 |
| InChIKey | OTHFLDVTGLRNJN-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.10 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |