C21H32N2O3S — CID 173136491
N-[2-[1-(benzenesulfonyl)pyrrolidin-3-yl]ethyl]cyclooctanecarboxamide (PubChem CID 173136491) has the molecular formula C21H32N2O3S and a molecular weight of 392.57 g/mol. Its IUPAC name is N-[2-[1-(benzenesulfonyl)pyrrolidin-3-yl]ethyl]cyclooctanecarboxamide.
| Compound Name | N-[2-[1-(benzenesulfonyl)pyrrolidin-3-yl]ethyl]cyclooctanecarboxamide |
|---|---|
| PubChem CID | 173136491 |
| Molecular Formula | C21H32N2O3S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-[2-[1-(benzenesulfonyl)pyrrolidin-3-yl]ethyl]cyclooctanecarboxamide |
| SMILES | O=C(NCCC1CCN(S(=O)(=O)c2ccccc2)C1)C1CCCCCCC1 |
| InChI | InChI=1S/C21H32N2O3S/c24-21(19-9-5-2-1-3-6-10-19)22-15-13-18-14-16-23(17-18)27(25,26)20-11-7-4-8-12-20/h4,7-8,11-12,18-19H,1-3,5-6,9-10,13-17H2,(H,22,24) |
| InChIKey | XXMFBWHNRBIXHY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |