C17H26N4O3S2 — CID 8729712
1-[[(3S)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]amino]-3-propan-2-ylthiourea (PubChem CID 8729712) has the molecular formula C17H26N4O3S2 and a molecular weight of 398.55 g/mol. Its IUPAC name is 1-[[(3S)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[[(3S)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 8729712 |
| Molecular Formula | C17H26N4O3S2 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 1-[[(3S)-1-(4-methylphenyl)sulfonylpiperidine-3-carbonyl]amino]-3-propan-2-ylthiourea |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC[C@H](C(=O)NNC(=S)NC(C)C)C2)cc1 |
| InChI | InChI=1S/C17H26N4O3S2/c1-12(2)18-17(25)20-19-16(22)14-5-4-10-21(11-14)26(23,24)15-8-6-13(3)7-9-15/h6-9,12,14H,4-5,10-11H2,1-3H3,(H,19,22)(H2,18,20,25)/t14-/m0/s1 |
| InChIKey | SNCZIABOOOYVNT-AWEZNQCLSA-N |
| XLogP | 1.30 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|