C12H24N4O3S2 — CID 17126894
1-[(1-ethylsulfonylpiperidine-3-carbonyl)amino]-3-propan-2-ylthiourea (PubChem CID 17126894) has the molecular formula C12H24N4O3S2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(1-ethylsulfonylpiperidine-3-carbonyl)amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[(1-ethylsulfonylpiperidine-3-carbonyl)amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 17126894 |
| Molecular Formula | C12H24N4O3S2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-[(1-ethylsulfonylpiperidine-3-carbonyl)amino]-3-propan-2-ylthiourea |
| SMILES | CCS(=O)(=O)N1CCCC(C(=O)NNC(=S)NC(C)C)C1 |
| InChI | InChI=1S/C12H24N4O3S2/c1-4-21(18,19)16-7-5-6-10(8-16)11(17)14-15-12(20)13-9(2)3/h9-10H,4-8H2,1-3H3,(H,14,17)(H2,13,15,20) |
| InChIKey | MHPWGIQTQUZNSW-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|