C25H22N2O4 — CID 32960065
[2-oxo-2-(4-phenylanilino)ethyl] 3-(cyclopropanecarbonylamino)benzoate (PubChem CID 32960065) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylanilino)ethyl] 3-(cyclopropanecarbonylamino)benzoate.
| Compound Name | [2-oxo-2-(4-phenylanilino)ethyl] 3-(cyclopropanecarbonylamino)benzoate |
|---|---|
| PubChem CID | 32960065 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [2-oxo-2-(4-phenylanilino)ethyl] 3-(cyclopropanecarbonylamino)benzoate |
| SMILES | O=C(COC(=O)c1cccc(NC(=O)C2CC2)c1)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22N2O4/c28-23(26-21-13-11-18(12-14-21)17-5-2-1-3-6-17)16-31-25(30)20-7-4-8-22(15-20)27-24(29)19-9-10-19/h1-8,11-15,19H,9-10,16H2,(H,26,28)(H,27,29) |
| InChIKey | YUHQYIBFBCJNBX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |