C23H24N2O8 — CID 27703682
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 27703682) has the molecular formula C23H24N2O8 and a molecular weight of 456.45 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 27703682 |
| Molecular Formula | C23H24N2O8 |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-[(2,5-dioxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc(CN3C(=O)CCC3=O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H24N2O8/c1-30-17-10-16(11-18(31-2)22(17)32-3)24-19(26)13-33-23(29)15-6-4-14(5-7-15)12-25-20(27)8-9-21(25)28/h4-7,10-11H,8-9,12-13H2,1-3H3,(H,24,26) |
| InChIKey | OWBGVXIAQCHDOU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|