C19H20N2O8 — CID 2628327
[2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-nitrobenzoate (PubChem CID 2628327) has the molecular formula C19H20N2O8 and a molecular weight of 404.38 g/mol. Its IUPAC name is [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 2628327 |
| Molecular Formula | C19H20N2O8 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | [2-oxo-2-(3,4,5-trimethoxyanilino)ethyl] 4-methyl-3-nitrobenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc(C)c([N+](=O)[O-])c2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N2O8/c1-11-5-6-12(7-14(11)21(24)25)19(23)29-10-17(22)20-13-8-15(26-2)18(28-4)16(9-13)27-3/h5-9H,10H2,1-4H3,(H,20,22) |
| InChIKey | TYLASVWZQXIBBX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|