C24H21F3N2O6 — CID 19059181
6-[[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 19059181) has the molecular formula C24H21F3N2O6 and a molecular weight of 490.43 g/mol. Its IUPAC name is 6-[[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 19059181 |
| Molecular Formula | C24H21F3N2O6 |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 6-[[4-[2-oxo-2-[3-(trifluoromethyl)anilino]ethoxy]carbonylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(COC(=O)c1ccc(NC(=O)C2CC=CCC2C(=O)O)cc1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H21F3N2O6/c25-24(26,27)15-4-3-5-17(12-15)28-20(30)13-35-23(34)14-8-10-16(11-9-14)29-21(31)18-6-1-2-7-19(18)22(32)33/h1-5,8-12,18-19H,6-7,13H2,(H,28,30)(H,29,31)(H,32,33) |
| InChIKey | CXSREQYKAAUNKM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|