C17H11ClF5NO5S — CID 16513329
[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate (PubChem CID 16513329) has the molecular formula C17H11ClF5NO5S and a molecular weight of 471.79 g/mol. Its IUPAC name is [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate.
| Compound Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
|---|---|
| PubChem CID | 16513329 |
| Molecular Formula | C17H11ClF5NO5S |
| Molecular Weight | 471.79 g/mol |
| Exact Mass | 471.00 |
| IUPAC Name | [2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl] 4-(difluoromethylsulfonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)C(F)F)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H11ClF5NO5S/c18-13-6-3-10(7-12(13)17(21,22)23)24-14(25)8-29-15(26)9-1-4-11(5-2-9)30(27,28)16(19)20/h1-7,16H,8H2,(H,24,25) |
| InChIKey | GGAGMZDSADMWAV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |