C18H15F4NO3 — CID 9386558
[(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-fluoro-4-methylbenzoate (PubChem CID 9386558) has the molecular formula C18H15F4NO3 and a molecular weight of 369.31 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-fluoro-4-methylbenzoate.
| Compound Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 9386558 |
| Molecular Formula | C18H15F4NO3 |
| Molecular Weight | 369.31 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(2S)-1-oxo-1-[3-(trifluoromethyl)anilino]propan-2-yl] 3-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@@H](C)C(=O)Nc2cccc(C(F)(F)F)c2)cc1F |
| InChI | InChI=1S/C18H15F4NO3/c1-10-6-7-12(8-15(10)19)17(25)26-11(2)16(24)23-14-5-3-4-13(9-14)18(20,21)22/h3-9,11H,1-2H3,(H,23,24)/t11-/m0/s1 |
| InChIKey | GLUWINPXLLRJGH-NSHDSACASA-N |
| XLogP | 4.34 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |