C21H25N3O5S — CID 55442585
[1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate (PubChem CID 55442585) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate.
| Compound Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
|---|---|
| PubChem CID | 55442585 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | [1-[4-(dimethylamino)anilino]-1-oxopropan-2-yl] 4-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoate |
| SMILES | CC(OC(=O)c1ccc(N2CCCS2(=O)=O)cc1)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H25N3O5S/c1-15(20(25)22-17-7-11-18(12-8-17)23(2)3)29-21(26)16-5-9-19(10-6-16)24-13-4-14-30(24,27)28/h5-12,15H,4,13-14H2,1-3H3,(H,22,25) |
| InChIKey | BZWYGNDVTCKLDN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|