C18H23N3O5 — CID 55441655
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-oxopiperidin-1-yl)benzoate (PubChem CID 55441655) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-oxopiperidin-1-yl)benzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-oxopiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 55441655 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-(2-oxopiperidin-1-yl)benzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1ccc(N2CCCCC2=O)cc1 |
| InChI | InChI=1S/C18H23N3O5/c1-3-19-18(25)20-16(23)12(2)26-17(24)13-7-9-14(10-8-13)21-11-5-4-6-15(21)22/h7-10,12H,3-6,11H2,1-2H3,(H2,19,20,23,25) |
| InChIKey | QUGMTNWINQCLEI-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |