C22H24N2O4 — CID 8544713
[(2R)-1-[(4-methylphenyl)methylamino]-1-oxopropan-2-yl] 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 8544713) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is [(2R)-1-[(4-methylphenyl)methylamino]-1-oxopropan-2-yl] 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [(2R)-1-[(4-methylphenyl)methylamino]-1-oxopropan-2-yl] 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 8544713 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | [(2R)-1-[(4-methylphenyl)methylamino]-1-oxopropan-2-yl] 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | Cc1ccc(CNC(=O)[C@@H](C)OC(=O)c2ccc(N3CCCC3=O)cc2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-15-5-7-17(8-6-15)14-23-21(26)16(2)28-22(27)18-9-11-19(12-10-18)24-13-3-4-20(24)25/h5-12,16H,3-4,13-14H2,1-2H3,(H,23,26)/t16-/m1/s1 |
| InChIKey | MPQDCBSGLMICTA-MRXNPFEDSA-N |
| XLogP | 2.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |