C14H18N2O4 — CID 7833961
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate (PubChem CID 7833961) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7833961 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-4-carboxylate |
| SMILES | C[C@H](OC(=O)c1cc[n+]([O-])cc1)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C14H18N2O4/c1-10(13(17)15-12-4-2-3-5-12)20-14(18)11-6-8-16(19)9-7-11/h6-10,12H,2-5H2,1H3,(H,15,17)/t10-/m0/s1 |
| InChIKey | YXJGGQZSNANXSH-JTQLQIEISA-N |
| XLogP | 0.92 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|