C16H22N2O4 — CID 8975075
[(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate (PubChem CID 8975075) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate.
| Compound Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 8975075 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [(2S)-1-(cycloheptylamino)-1-oxopropan-2-yl] 1-oxidopyridin-1-ium-2-carboxylate |
| SMILES | C[C@H](OC(=O)c1cccc[n+]1[O-])C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C16H22N2O4/c1-12(15(19)17-13-8-4-2-3-5-9-13)22-16(20)14-10-6-7-11-18(14)21/h6-7,10-13H,2-5,8-9H2,1H3,(H,17,19)/t12-/m0/s1 |
| InChIKey | KGLIWTCGGLEPCH-LBPRGKRZSA-N |
| XLogP | 1.70 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|